trinitymiller99 trinitymiller99

04-02-2022
Mathematics

contestada

rewrite 2/9x-5=2/3 so it doesnt have any fractions

Respuesta :

dudleycierra024 dudleycierra024

04-02-2022

Answer: 5x + 63 = 6

Step-by-step explanation:

5/9x + 7 = 2/3

9(5/9x + 7 = 2/3)

5x + 63 = 6

-Hope this helps <3

Answer Link

Otras preguntas

What two kinds of elements join together to form an ionic compound?

A curve has equation y=x√x.find the equation of the tangent to the curve at the point(1, 5)

cosec(6b+pi/8)=sec(2b-pi/8)

Under the Articles of Confederation, there was no separate judicial branch. Which of the following problems did this create? A) Judges could not make any ruling

Why can evaporation be used to separate a mixture? check all that apply. One or more components has a lower boiling point than the de

Using the electron configuration flow diagram below what is the correct electron configuration for chlorine atomic number 17

Find the mean: -2, 8, -3, 4, -6

What is the equation of the line that passes through the point (5,0) and has a slope of 1

BRAINLIEST ANSWER IS GOING TO BE GIVENUse the drop-down menus to complete the statements below to answer this question: Can you determine whether a system of l

the first car has a fuel efficiency of a 40 miles per gallon of gas at the second has a fuel efficiency of 20 miles per gallon of gas during one particular week