grglucifer20
grglucifer20 grglucifer20
  • 02-09-2020
  • Health
contestada

How are biological and sociocultural aspects of environment related to health and population. Explain?​

Respuesta :

samridhikarki
samridhikarki samridhikarki
  • 02-09-2020

Biological environment determines the health of the individuals. People get nutritive food where there is good agricultural production and consequently become healthy. In this way health, population and environment education are interrelated in biological aspect.

Answer Link

Otras preguntas

Which of the following are characteristics of the graph of the reciprocal parent function? check all that apply a. it is in quadrant 1 and 3 b. it goes throug
What is 10% of $190?
A supporting sentence _____. A.introduces a new main idea into a paragraph B.transitions ideas from one paragraph to the next C.concludes a paragraph by restati
Calculate the average rate of change for the given function, from x = −3 to x = 7. x f(x) −3 50 3 10 7 0
I don't understand this paper
Cocaine is an opiate. true or false
cos(x/3)cos(x/3)=1/2(1+cos(2x/3))
who is most responsible for the deaths of romeo and Juliet?
What is the answer of these compound
find the area of a triangle when a=78 degrees b=14 c=12